MIF-IN-4 hydrochloride structure
|
Common Name | MIF-IN-4 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2489514-05-6 | Molecular Weight | 493.00 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H29ClN6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MIF-IN-4 hydrochlorideMIF-IN-4 hydrochloride is potent macrophage migration inhibitory factor (MIF) inhibitor (pIC50=5.01-6). MIF is a cytokine originally found to play a role in inhibiting macrophage migration[1]. |
| Name | MIF-IN-4 hydrochloride |
|---|
| Description | MIF-IN-4 hydrochloride is potent macrophage migration inhibitory factor (MIF) inhibitor (pIC50=5.01-6). MIF is a cytokine originally found to play a role in inhibiting macrophage migration[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C26H29ClN6O2 |
|---|---|
| Molecular Weight | 493.00 |
| InChIKey | JPZMCQXVFKETSO-UHFFFAOYSA-N |
| SMILES | Cl.OCCn1ccc2c(N3CCc4ccccc43)nc(N3CCN(c4ccc(O)cc4)CC3)nc21 |