Methyl tuberuculostearate structure
|
Common Name | Methyl tuberuculostearate | ||
|---|---|---|---|---|
| CAS Number | 2490-19-9 | Molecular Weight | 312.53000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H40O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 10-methyloctadecanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H40O2 |
|---|---|
| Molecular Weight | 312.53000 |
| Exact Mass | 312.30300 |
| PSA | 26.30000 |
| LogP | 6.66690 |
| InChIKey | ATERKICZYCBQCQ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(C)CCCCCCCCC(=O)OC |
| HS Code | 2915900090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| methyl (R,S)-10-methyloctadecanoate |
| (+-)-10-Methyl-stearinsaeure-methylester |
| Methyl-10-methyloctadecanoat |
| 10-Methyl-octadecansaeure-methylester |
| 9-Methyl-octadecan-18-saeuremethylester |
| Octadecanoic acid,10-methyl-,methyl ester |
| (+-)-10-methyl-stearic acid methyl ester |
| Octadecanoic acid,10-methyl-,methyl ester,(R) |
| Tuberculostearinsaeure-methylester |