[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-phenyldiazenylbenzoate structure
|
Common Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-phenyldiazenylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 24909-60-2 | Molecular Weight | 594.86900 | |
| Density | 1.13g/cm3 | Boiling Point | 674ºC at 760 mmHg | |
| Molecular Formula | C40H54N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.5ºC | |
| Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-phenyldiazenylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 674ºC at 760 mmHg |
| Molecular Formula | C40H54N2O2 |
| Molecular Weight | 594.86900 |
| Flash Point | 163.5ºC |
| Exact Mass | 594.41900 |
| PSA | 51.02000 |
| LogP | 11.66880 |
| Vapour Pressure | 5.01E-18mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | ZJEHXCIPPYQSCO-HOKOKXPTSA-N |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)c5ccc(N=Nc6ccccc6)cc5)CCC4(C)C3CCC12C |
|
~%
[(3S,8S,9S,10R,... CAS#:24909-60-2 |
| Literature: Ladenburg; Fernholz; Wallis Journal of Organic Chemistry, 1938 , vol. 3, p. 294,295, 298 |
|
~%
[(3S,8S,9S,10R,... CAS#:24909-60-2 |
| Literature: Ladenburg; Fernholz; Wallis Journal of Organic Chemistry, 1938 , vol. 3, p. 294,295, 298 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| n-Octyl Carbonic Acid Cholesterol Ester |
| Cholesterol n-Octyl Carbonate |
| p-Phenylazo-benzoesaeure-cholesterylester |
| Cholesteryl-p-phenylazobenzoate |
| Cholesteryl-n-octyl-carbonat |
| Cholesteryloctylcarbonat |