1,4-dichloro-2-phenoxy-benzene structure
|
Common Name | 1,4-dichloro-2-phenoxy-benzene | ||
|---|---|---|---|---|
| CAS Number | 24910-69-8 | Molecular Weight | 239.09700 | |
| Density | 1.3g/cm3 | Boiling Point | 295.6ºC at 760mmHg | |
| Molecular Formula | C12H8Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 83.1ºC | |
| Name | 1,4-dichloro-2-phenoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 295.6ºC at 760mmHg |
| Molecular Formula | C12H8Cl2O |
| Molecular Weight | 239.09700 |
| Flash Point | 83.1ºC |
| Exact Mass | 237.99500 |
| PSA | 9.23000 |
| LogP | 4.78570 |
| Vapour Pressure | 0.00266mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | VITXVDNQHXYQSK-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Cl)c(Oc2ccccc2)c1 |
| HS Code | 2909309090 |
|---|
|
~%
1,4-dichloro-2-... CAS#:24910-69-8
Detail
|
| Literature: Muganlinskii, F. F.; Sandler, O. L.; Kakhramanov, V. B.; Guseinova, D. D. J. Appl. Chem. USSR (Engl. Transl.), 1990 , vol. 63, # 4 p. 914 - 916,854 - 856 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene,1,4-dichloro-2-phenoxy |
| 2,5-dichlorodiphenyl oxide |
| 1,4-dichloro-2-phenoxy-benzene |