1,3-dichloro-5-(4-chlorophenoxy)benzene structure
|
Common Name | 1,3-dichloro-5-(4-chlorophenoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 24910-73-4 | Molecular Weight | 273.54200 | |
| Density | 1.396g/cm3 | Boiling Point | 343.8ºC at 760 mmHg | |
| Molecular Formula | C12H7Cl3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.3ºC | |
| Name | 1,3-dichloro-5-(4-chlorophenoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.396g/cm3 |
|---|---|
| Boiling Point | 343.8ºC at 760 mmHg |
| Molecular Formula | C12H7Cl3O |
| Molecular Weight | 273.54200 |
| Flash Point | 129.3ºC |
| Exact Mass | 271.95600 |
| PSA | 9.23000 |
| LogP | 5.43910 |
| Vapour Pressure | 0.000137mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | CCEZFZGXWFJQEF-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Oc2cc(Cl)cc(Cl)c2)cc1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3,4',5-PCDE |
| PCDE 39 |
| Benzene,1,3-dichloro-5-(4-chlorophenoxy) |
| Ether,p-chlorophenyl 3,5-dichlorophenyl (8CI) |