Molnupiravir
Modify Date: 2026-06-07 17:36:59
Molnupiravir structure
|
Common Name | Molnupiravir | ||
|---|---|---|---|---|
| CAS Number | 2492423-30-8 | Molecular Weight | 329.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Molnupiravir |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H19N3O7 |
|---|---|
| Molecular Weight | 329.31 |
| InChIKey | HTNPEHXGEKVIHG-QCNRFFRDSA-N |
| SMILES | CC(C)C(=O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=CC(=NC2=O)NO)O)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 31, Current Page 1 of 4
1
2
3
4
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Molnupiravir? |
| A: The English name of Molnupiravir is Molnupiravir. |
| Q: What is the Chinese name of 2492423-30-8? |
| A: Chinese name of 2492423-30-8 is 2492423-30-8. |
| Q: What is the InChIKey of Molnupiravir? |
| A: InChIKey of Molnupiravir is HTNPEHXGEKVIHG-QCNRFFRDSA-N. |
| Q: What is the molecular weight of Molnupiravir? |
| A: Molecular weight of Molnupiravir is 329.31. |
| Q: What is the CAS number of Molnupiravir? |
| A: CAS number of Molnupiravir is 2492423-30-8. |
| Q: What is the molecular formula of Molnupiravir? |
| A: Molecular formula of Molnupiravir is C13H19N3O7. |
| Q: What is the SMILES notation of Molnupiravir? |
| A: SMILES notation of Molnupiravir is CC(C)C(=O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=CC(=NC2=O)NO)O)O. |