MRGPRX4 modulator-2 structure
|
Common Name | MRGPRX4 modulator-2 | ||
|---|---|---|---|---|
| CAS Number | 2492595-24-9 | Molecular Weight | 348.68 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H9ClF4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MRGPRX4 modulator-2MRGPRX4 modulator-2 (compound 1-55) is a potent MRGPR X4 modulator, possessing antagonist activity against MRGPR X4 with an IC50 < 100 nM. MRGPRX4 modulator-2 can be used for researching autoimmune diseases such as psoriasis, multiple sclerosis, Steven Johnson’s Syndrome, and other chronic itch conditions[1]. |
| Name | MRGPRX4 modulator-2 |
|---|
| Description | MRGPRX4 modulator-2 (compound 1-55) is a potent MRGPR X4 modulator, possessing antagonist activity against MRGPR X4 with an IC50 < 100 nM. MRGPRX4 modulator-2 can be used for researching autoimmune diseases such as psoriasis, multiple sclerosis, Steven Johnson’s Syndrome, and other chronic itch conditions[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: < 100 nM (MRGPR X4)[1] |
| References |
| Molecular Formula | C15H9ClF4O3 |
|---|---|
| Molecular Weight | 348.68 |
| InChIKey | TWOXPNAILYKJPT-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(COc2ccc(C(F)(F)F)cc2Cl)c1F |