3-[(2,4-Dichlorophenoxy)methyl]-4-methylbenzoic acid
Modify Date: 2026-06-27 00:50:24
![3-[(2,4-Dichlorophenoxy)methyl]-4-methylbenzoic acid Structure](https://www.chemsrc.com/extcaspic/238/2492596-34-4.png)
3-[(2,4-Dichlorophenoxy)methyl]-4-methylbenzoic acid structure
|
Common Name | 3-[(2,4-Dichlorophenoxy)methyl]-4-methylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 2492596-34-4 | Molecular Weight | 311.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[(2,4-Dichlorophenoxy)methyl]-4-methylbenzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H12Cl2O3 |
|---|---|
| Molecular Weight | 311.2 |
| InChIKey | HLIOVJFLODAYQT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)COC2=C(C=C(C=C2)Cl)Cl |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Antagonist activity at human MRGPRX4 expressed in HEK cells incubated in dark for 1 h...
Source: ChEMBL
Target: Mas-related G-protein coupled receptor member X4
External Id: CHEMBL4808118
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-[(2,4-Dichlorophenoxy)methyl]-4-methylbenzoic acid? |
| A: CAS number of 3-[(2,4-Dichlorophenoxy)methyl]-4-methylbenzoic acid is 2492596-34-4. |
| Q: What is the Chinese name of 2492596-34-4? |
| A: Chinese name of 2492596-34-4 is 2492596-34-4. |
| Q: What is the molecular formula of 3-[(2,4-Dichlorophenoxy)methyl]-4-methylbenzoic acid? |
| A: Molecular formula of 3-[(2,4-Dichlorophenoxy)methyl]-4-methylbenzoic acid is C15H12Cl2O3. |
| Q: What is the molecular weight of 3-[(2,4-Dichlorophenoxy)methyl]-4-methylbenzoic acid? |
| A: Molecular weight of 3-[(2,4-Dichlorophenoxy)methyl]-4-methylbenzoic acid is 311.2. |
| Q: What is the InChIKey of 3-[(2,4-Dichlorophenoxy)methyl]-4-methylbenzoic acid? |
| A: InChIKey of 3-[(2,4-Dichlorophenoxy)methyl]-4-methylbenzoic acid is HLIOVJFLODAYQT-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-[(2,4-Dichlorophenoxy)methyl]-4-methylbenzoic acid? |
| A: SMILES notation of 3-[(2,4-Dichlorophenoxy)methyl]-4-methylbenzoic acid is CC1=C(C=C(C=C1)C(=O)O)COC2=C(C=C(C=C2)Cl)Cl. |
| Q: What is the English name of 3-[(2,4-Dichlorophenoxy)methyl]-4-methylbenzoic acid? |
| A: The English name of 3-[(2,4-Dichlorophenoxy)methyl]-4-methylbenzoic acid is 3-[(2,4-Dichlorophenoxy)methyl]-4-methylbenzoic acid. |