6-[4-(α-Methylphenethyl)-1-piperazinyl]-9H-purine structure
|
Common Name | 6-[4-(α-Methylphenethyl)-1-piperazinyl]-9H-purine | ||
|---|---|---|---|---|
| CAS Number | 24926-55-4 | Molecular Weight | 322.40700 | |
| Density | 1.251g/cm3 | Boiling Point | 566.3ºC at 760 mmHg | |
| Molecular Formula | C18H22N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.3ºC | |
| Name | 6-[4-(1-phenylpropan-2-yl)piperazin-1-yl]-7H-purine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.251g/cm3 |
|---|---|
| Boiling Point | 566.3ºC at 760 mmHg |
| Molecular Formula | C18H22N6 |
| Molecular Weight | 322.40700 |
| Flash Point | 296.3ºC |
| Exact Mass | 322.19100 |
| PSA | 60.94000 |
| LogP | 2.10900 |
| Vapour Pressure | 7.61E-13mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | SVDQCIVZJZCQJQ-UHFFFAOYSA-N |
| SMILES | CC(Cc1ccccc1)N1CCN(c2ncnc3nc[nH]c23)CC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-[4-(1-methyl-2-phenyl-ethyl)-piperazin-1-yl]-7(9)H-purine |