calcium bis(hydrogen D-threo-hexo-2,5-diulosonate)
calcium bis(hydrogen D-threo-hexo-2,5-diulosonate) structure
|
Common Name | calcium bis(hydrogen D-threo-hexo-2,5-diulosonate) | ||
|---|---|---|---|---|
| CAS Number | 24940-63-4 | Molecular Weight | 422.30900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14CaO14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | calcium,(3S,4S)-3,4,6-trihydroxy-2,5-dioxohexanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14CaO14 |
|---|---|
| Molecular Weight | 422.30900 |
| Exact Mass | 422.00100 |
| PSA | 269.92000 |
| InChIKey | RKFLKNFLAJISPF-UHFFFAOYSA-L |
| SMILES | O=C([O-])C(=O)C(O)C(O)C(=O)CO.O=C([O-])C(=O)C(O)C(O)C(=O)CO.[Ca+2] |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:533-50-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,5-Dioxo-D-gluconate |
| CalciumD-threo-2,5-hexodiulosonate |
| 2,5-Diketogluconate |
| EINECS 246-542-3 |
| Calcium 2,5-diketogluconic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of calcium,(3S,4S)-3,4,6-trihydroxy-2,5-dioxohexanoate? |
| A: Molecular weight of calcium,(3S,4S)-3,4,6-trihydroxy-2,5-dioxohexanoate is 422.30900. |
| Q: What are the downstream products of calcium,(3S,4S)-3,4,6-trihydroxy-2,5-dioxohexanoate? |
| A: Related downstream products(CAS) of calcium,(3S,4S)-3,4,6-trihydroxy-2,5-dioxohexanoate: 533-50-6. |
| Q: What English synonyms does calcium,(3S,4S)-3,4,6-trihydroxy-2,5-dioxohexanoate have? |
| A: English synonyms of calcium,(3S,4S)-3,4,6-trihydroxy-2,5-dioxohexanoate: 2,5-Dioxo-D-gluconate, CalciumD-threo-2,5-hexodiulosonate, 2,5-Diketogluconate, EINECS 246-542-3, Calcium 2,5-diketogluconic acid. |
| Q: What is the Chinese name of 24940-63-4? |
| A: Chinese name of 24940-63-4 is 24940-63-4. |
| Q: What is the SMILES notation of calcium,(3S,4S)-3,4,6-trihydroxy-2,5-dioxohexanoate? |
| A: SMILES notation of calcium,(3S,4S)-3,4,6-trihydroxy-2,5-dioxohexanoate is O=C([O-])C(=O)C(O)C(O)C(=O)CO.O=C([O-])C(=O)C(O)C(O)C(=O)CO.[Ca+2]. |
| Q: What is the CAS number of calcium,(3S,4S)-3,4,6-trihydroxy-2,5-dioxohexanoate? |
| A: CAS number of calcium,(3S,4S)-3,4,6-trihydroxy-2,5-dioxohexanoate is 24940-63-4. |
| Q: What is the English name of calcium,(3S,4S)-3,4,6-trihydroxy-2,5-dioxohexanoate? |
| A: The English name of calcium,(3S,4S)-3,4,6-trihydroxy-2,5-dioxohexanoate is calcium,(3S,4S)-3,4,6-trihydroxy-2,5-dioxohexanoate. |
| Q: What is the InChIKey of calcium,(3S,4S)-3,4,6-trihydroxy-2,5-dioxohexanoate? |
| A: InChIKey of calcium,(3S,4S)-3,4,6-trihydroxy-2,5-dioxohexanoate is RKFLKNFLAJISPF-UHFFFAOYSA-L. |
| Q: What is the polar surface area (PSA) of calcium,(3S,4S)-3,4,6-trihydroxy-2,5-dioxohexanoate? |
| A: Polar surface area (PSA) of calcium,(3S,4S)-3,4,6-trihydroxy-2,5-dioxohexanoate is 269.92000. |
| Q: What is the molecular formula of calcium,(3S,4S)-3,4,6-trihydroxy-2,5-dioxohexanoate? |
| A: Molecular formula of calcium,(3S,4S)-3,4,6-trihydroxy-2,5-dioxohexanoate is C12H14CaO14. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |