2-bromo-5-(2,4-dibromophenoxy)phenol structure
|
Common Name | 2-bromo-5-(2,4-dibromophenoxy)phenol | ||
|---|---|---|---|---|
| CAS Number | 24949-30-2 | Molecular Weight | 422.89500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7Br3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-5-(2,4-dibromophenoxy)phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H7Br3O2 |
|---|---|
| Molecular Weight | 422.89500 |
| Exact Mass | 419.80000 |
| PSA | 29.46000 |
| LogP | 5.47200 |
| InChIKey | NATAVEHSIYVLEC-UHFFFAOYSA-N |
| SMILES | Oc1cc(Oc2ccc(Br)cc2Br)ccc1Br |
|
~29%
2-bromo-5-(2,4-... CAS#:24949-30-2 |
| Literature: Marsh, Goeran; Stenutz, Roland; Bergman, Ake European Journal of Organic Chemistry, 2003 , # 14 p. 2566 - 2576 |
|
~%
2-bromo-5-(2,4-... CAS#:24949-30-2 |
| Literature: Marsh, Goeran; Stenutz, Roland; Bergman, Ake European Journal of Organic Chemistry, 2003 , # 14 p. 2566 - 2576 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 3'-hydroxy-2,4,4'-tribromodiphenyl ether |
| Tribrom-m-phenoxyphenol |
| 3'-OH-BDE28 |
| Phenol,2-bromo-5-(2,4-dibromophenoxy) |
| 6-bromo-3-(2,4-dibromophenoxy)phenol |