1H-Indole-2-carboxylicacid, 5-methoxy-6-(phenylmethoxy)- structure
|
Common Name | 1H-Indole-2-carboxylicacid, 5-methoxy-6-(phenylmethoxy)- | ||
|---|---|---|---|---|
| CAS Number | 2495-92-3 | Molecular Weight | 297.30500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15NO4 | Melting Point | 230-232 ℃(dec.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | 6-Benzyloxy-5-methoxyindole-2-carboxylic Acid |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 230-232 ℃(dec.) |
|---|---|
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.30500 |
| Exact Mass | 297.10000 |
| PSA | 71.55000 |
| LogP | 3.45370 |
| InChIKey | JMOOGCFXFNKYCS-UHFFFAOYSA-N |
| SMILES | COc1cc2cc(C(=O)O)[nH]c2cc1OCc1ccccc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Benzyloxy-5-methoxyindole-2-carboxylicAcid |
| 5-methoxy-6-phenylmethoxy-1H-indole-2-carboxylic acid |