Phenol,4-[2-(4-chlorophenyl)diazenyl]-2-methyl- structure
|
Common Name | Phenol,4-[2-(4-chlorophenyl)diazenyl]-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 2497-44-1 | Molecular Weight | 246.69200 | |
| Density | 1.23g/cm3 | Boiling Point | 365.7ºC at 760 mmHg | |
| Molecular Formula | C13H11ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175ºC | |
| Name | (4E)-4-[(4-chlorophenyl)hydrazinylidene]-2-methylcyclohexa-2,5-dien-1-one |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 365.7ºC at 760 mmHg |
| Molecular Formula | C13H11ClN2O |
| Molecular Weight | 246.69200 |
| Flash Point | 175ºC |
| Exact Mass | 246.05600 |
| PSA | 44.95000 |
| LogP | 4.76940 |
| Vapour Pressure | 1.54E-05mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | WSQPSJQJPHSRAV-UHFFFAOYSA-N |
| SMILES | Cc1cc(N=Nc2ccc(Cl)cc2)ccc1O |
|
~%
Phenol,4-[2-(4-... CAS#:2497-44-1 |
| Literature: Ettel; Myska Collection of Czechoslovak Chemical Communications, 1958 , vol. 23, p. 1341,1342,1344 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |