2-amino-3,5-ditert-butylphenol structure
|
Common Name | 2-amino-3,5-ditert-butylphenol | ||
|---|---|---|---|---|
| CAS Number | 24973-57-7 | Molecular Weight | 221.33900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-3,5-ditert-butylphenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H23NO |
|---|---|
| Molecular Weight | 221.33900 |
| Exact Mass | 221.17800 |
| PSA | 46.25000 |
| LogP | 4.15060 |
| InChIKey | CLRBDDUMPXYLHE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(O)c(N)c(C(C)(C)C)c1 |
| HS Code | 2922299090 |
|---|
|
~%
2-amino-3,5-dit... CAS#:24973-57-7 |
| Literature: Harmalker, Subhash P.; Sawyer, Donald T. Journal of Organic Chemistry, 1984 , vol. 49, # 19 p. 3579 - 3583 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Amino-3,5-di-tert.-butyl-phenol |
| 2-amino-3,5-bis(tert-butyl)phenol |
| 3,5-Di-tert-butyl-2-aminophenol |