Diethyl (3S)-2-(4-ethoxyphenyl)-2,3-dihydro-1H-naphtho[1,2-e][1,3]oxazine-1,3-dicarboxylate
Modify Date: 2026-07-22 18:53:27
![Diethyl (3S)-2-(4-ethoxyphenyl)-2,3-dihydro-1H-naphtho[1,2-e][1,3]oxazine-1,3-dicarboxylate Structure](https://www.chemsrc.com/extcaspic/438/2497331-87-8.png)
Diethyl (3S)-2-(4-ethoxyphenyl)-2,3-dihydro-1H-naphtho[1,2-e][1,3]oxazine-1,3-dicarboxylate structure
|
Common Name | Diethyl (3S)-2-(4-ethoxyphenyl)-2,3-dihydro-1H-naphtho[1,2-e][1,3]oxazine-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 2497331-87-8 | Molecular Weight | 449.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H27NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Diethyl (3S)-2-(4-ethoxyphenyl)-2,3-dihydro-1H-naphtho[1,2-e][1,3]oxazine-1,3-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H27NO6 |
|---|---|
| Molecular Weight | 449.5 |
| InChIKey | JHWBGDNBRZGJKP-CGAIIQECSA-N |
| SMILES | CCOC(=O)C1Oc2ccc3ccccc3c2C(C(=O)OCC)N1c1ccc(OCC)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Diethyl (3S)-2-(4-ethoxyphenyl)-2,3-dihydro-1H-naphtho[1,2-e][1,3]oxazine-1,3-dicarboxylate? |
| A: CAS number of Diethyl (3S)-2-(4-ethoxyphenyl)-2,3-dihydro-1H-naphtho[1,2-e][1,3]oxazine-1,3-dicarboxylate is 2497331-87-8. |
| Q: What is the molecular weight of Diethyl (3S)-2-(4-ethoxyphenyl)-2,3-dihydro-1H-naphtho[1,2-e][1,3]oxazine-1,3-dicarboxylate? |
| A: Molecular weight of Diethyl (3S)-2-(4-ethoxyphenyl)-2,3-dihydro-1H-naphtho[1,2-e][1,3]oxazine-1,3-dicarboxylate is 449.5. |
| Q: What is the Chinese name of 2497331-87-8? |
| A: Chinese name of 2497331-87-8 is 2497331-87-8. |
| Q: What is the InChIKey of Diethyl (3S)-2-(4-ethoxyphenyl)-2,3-dihydro-1H-naphtho[1,2-e][1,3]oxazine-1,3-dicarboxylate? |
| A: InChIKey of Diethyl (3S)-2-(4-ethoxyphenyl)-2,3-dihydro-1H-naphtho[1,2-e][1,3]oxazine-1,3-dicarboxylate is JHWBGDNBRZGJKP-CGAIIQECSA-N. |
| Q: What is the SMILES notation of Diethyl (3S)-2-(4-ethoxyphenyl)-2,3-dihydro-1H-naphtho[1,2-e][1,3]oxazine-1,3-dicarboxylate? |
| A: SMILES notation of Diethyl (3S)-2-(4-ethoxyphenyl)-2,3-dihydro-1H-naphtho[1,2-e][1,3]oxazine-1,3-dicarboxylate is CCOC(=O)C1Oc2ccc3ccccc3c2C(C(=O)OCC)N1c1ccc(OCC)cc1. |
| Q: What is the English name of Diethyl (3S)-2-(4-ethoxyphenyl)-2,3-dihydro-1H-naphtho[1,2-e][1,3]oxazine-1,3-dicarboxylate? |
| A: The English name of Diethyl (3S)-2-(4-ethoxyphenyl)-2,3-dihydro-1H-naphtho[1,2-e][1,3]oxazine-1,3-dicarboxylate is Diethyl (3S)-2-(4-ethoxyphenyl)-2,3-dihydro-1H-naphtho[1,2-e][1,3]oxazine-1,3-dicarboxylate. |
| Q: What is the molecular formula of Diethyl (3S)-2-(4-ethoxyphenyl)-2,3-dihydro-1H-naphtho[1,2-e][1,3]oxazine-1,3-dicarboxylate? |
| A: Molecular formula of Diethyl (3S)-2-(4-ethoxyphenyl)-2,3-dihydro-1H-naphtho[1,2-e][1,3]oxazine-1,3-dicarboxylate is C26H27NO6. |