ethyl prop-2-enoate,2-methylidenebutanedioic acid,methyl 2-methylprop-2-enoate structure
|
Common Name | ethyl prop-2-enoate,2-methylidenebutanedioic acid,methyl 2-methylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 24980-96-9 | Molecular Weight | 330.33000 | |
| Density | N/A | Boiling Point | 381.4ºC at 760mmHg | |
| Molecular Formula | C15H22O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.7ºC | |
| Name | ethyl prop-2-enoate,2-methylidenebutanedioic acid,methyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 381.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C15H22O8 |
| Molecular Weight | 330.33000 |
| Flash Point | 198.7ºC |
| Exact Mass | 330.13100 |
| PSA | 127.20000 |
| LogP | 1.57290 |
| Vapour Pressure | 7.11E-07mmHg at 25°C |
| InChIKey | VUUAVLBOFWERGO-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OC.C=C(CC(=O)O)C(=O)O.C=CC(=O)OCC |
| Ethyl acrylate,methyl methacrylate,itaconic acid polymer |
| Butanedioic acid,methylene-,polymer with ethyl 2-propenoate and methyl 2-methyl-2-propenoate |