ethyl 2-methylprop-2-enoate,prop-2-enenitrile,prop-2-enoic acid structure
|
Common Name | ethyl 2-methylprop-2-enoate,prop-2-enenitrile,prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 24981-02-0 | Molecular Weight | 239.26800 | |
| Density | N/A | Boiling Point | 120.5ºC at 760mmHg | |
| Molecular Formula | C12H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 15.6ºC | |
| Name | ethyl 2-methylprop-2-enoate,prop-2-enenitrile,prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 120.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.26800 |
| Flash Point | 15.6ºC |
| Exact Mass | 239.11600 |
| PSA | 87.39000 |
| LogP | 2.07858 |
| Vapour Pressure | 15.2mmHg at 25°C |
| InChIKey | WUCDQVHBUYQIJJ-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCC.C=CC#N.C=CC(=O)O |
| 2-Propenoic acid,2-methyl-,ethyl ester,polymer with 2-propenenitrile and 2-propenoic acid |
| Ethyl methacrylate,acrylonitrile,acrylic acid polymer |