methyl 3-(2-morpholin-4-ylethoxy)benzoate structure
|
Common Name | methyl 3-(2-morpholin-4-ylethoxy)benzoate | ||
|---|---|---|---|---|
| CAS Number | 249937-00-6 | Molecular Weight | 265.30500 | |
| Density | 1.141g/cm3 | Boiling Point | 396.9ºC at 760 mmHg | |
| Molecular Formula | C14H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.9ºC | |
| Name | methyl 3-(2-morpholin-4-ylethoxy)benzoate |
|---|
| Density | 1.141g/cm3 |
|---|---|
| Boiling Point | 396.9ºC at 760 mmHg |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.30500 |
| Flash Point | 193.9ºC |
| Exact Mass | 265.13100 |
| PSA | 48.00000 |
| LogP | 1.12210 |
| Vapour Pressure | 1.65E-06mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | VOYSHDFODOJUMP-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc(OCCN2CCOCC2)c1 |
|
~99%
methyl 3-(2-mor... CAS#:249937-00-6 |
| Literature: Bartkovitz, David Joseph; Chen, Yi; Chu, Xin-Jie; Luk, Kin-Chun; Rossman, Pamela Loreen; So, Sung-Sau Patent: US2007/60607 A1, 2007 ; Location in patent: Page/Page column 60 ; US 20070060607 A1 |
|
~%
methyl 3-(2-mor... CAS#:249937-00-6 |
| Literature: Goldstein, David M.; Alfredson, Tom; Bertrand, Jay; Browner, Michelle F.; Clifford, Ken; Dalrymple, Stacie A.; Dunn, James; Freire-Moar, Jose; Harris, Seth; Labadie, Sharada S.; La Fargue, JoAnn; Lapierre, Jean Marc; Larrabee, Susan; Li, Fujun; Papp, Eva; McWeeney, Daniel; Ramesha, Chakk; Roberts, Rick; Rotstein, David; San Pablo, Bong; Sjogren, Eric B.; So, On-Yee; Talamas, Francisco X.; Tao, Will; Trejo, Alejandra; Villasenor, Armando; Welch, Mary; Welch, Teresa; Weller, Paul; Whiteley, Phyllis E.; Young, Kelly; Zipfel, Sheila Journal of Medicinal Chemistry, 2006 , vol. 49, # 5 p. 1562 - 1575 |