benzyl (2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate
Modify Date: 2026-07-28 14:11:13
benzyl (2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate structure
|
Common Name | benzyl (2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 250149-33-8 | Molecular Weight | 248.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl (2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11F3O3 |
|---|---|
| Molecular Weight | 248.20 |
| InChIKey | ZIXXABZSYXRCJO-SNVBAGLBSA-N |
| SMILES | CC(O)(C(=O)OCc1ccccc1)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of benzyl (2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate? |
| A: CAS number of benzyl (2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate is 250149-33-8. |
| Q: What is the InChIKey of benzyl (2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate? |
| A: InChIKey of benzyl (2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate is ZIXXABZSYXRCJO-SNVBAGLBSA-N. |
| Q: What is the molecular weight of benzyl (2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate? |
| A: Molecular weight of benzyl (2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate is 248.20. |
| Q: What is the SMILES notation of benzyl (2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate? |
| A: SMILES notation of benzyl (2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate is CC(O)(C(=O)OCc1ccccc1)C(F)(F)F. |
| Q: What is the molecular formula of benzyl (2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate? |
| A: Molecular formula of benzyl (2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate is C11H11F3O3. |
| Q: What is the English name of benzyl (2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate? |
| A: The English name of benzyl (2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate is benzyl (2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate. |
| Q: What is the Chinese name of 250149-33-8? |
| A: Chinese name of 250149-33-8 is 250149-33-8. |