CID 155822481
Modify Date: 2025-09-04 15:11:08
CID 155822481 structure
|
Common Name | CID 155822481 | ||
|---|---|---|---|---|
| CAS Number | 2503155-64-2 | Molecular Weight | 323.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CID 155822481 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H21NO4S |
|---|---|
| Molecular Weight | 323.4 |
| InChIKey | NVQKPFUBZOMCLZ-GOEBONIOSA-N |
| SMILES | COC(=O)C12CCS(=O)(=O)CC1CN(Cc1ccccc1)C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of CID 155822481? |
| A: Molecular weight of CID 155822481 is 323.4. |
| Q: What is the SMILES notation of CID 155822481? |
| A: SMILES notation of CID 155822481 is COC(=O)C12CCS(=O)(=O)CC1CN(Cc1ccccc1)C2. |
| Q: What is the CAS number of CID 155822481? |
| A: CAS number of CID 155822481 is 2503155-64-2. |
| Q: What is the InChIKey of CID 155822481? |
| A: InChIKey of CID 155822481 is NVQKPFUBZOMCLZ-GOEBONIOSA-N. |
| Q: What is the English name of CID 155822481? |
| A: The English name of CID 155822481 is CID 155822481. |
| Q: What is the molecular formula of CID 155822481? |
| A: Molecular formula of CID 155822481 is C16H21NO4S. |
| Q: What is the Chinese name of 2503155-64-2? |
| A: Chinese name of 2503155-64-2 is 2503155-64-2. |