2-[4-(Carboxymethyl)pyrrolidin-3-yl]acetic acid hydrochloride
Modify Date: 2025-09-13 11:59:10
![2-[4-(Carboxymethyl)pyrrolidin-3-yl]acetic acid hydrochloride Structure](https://www.chemsrc.com/extcaspic/067/2503205-73-8.png)
2-[4-(Carboxymethyl)pyrrolidin-3-yl]acetic acid hydrochloride structure
|
Common Name | 2-[4-(Carboxymethyl)pyrrolidin-3-yl]acetic acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2503205-73-8 | Molecular Weight | 223.65 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H14ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[4-(Carboxymethyl)pyrrolidin-3-yl]acetic acid hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H14ClNO4 |
|---|---|
| Molecular Weight | 223.65 |
| InChIKey | MVPZEQHRILWQMC-UHFFFAOYSA-N |
| SMILES | Cl.O=C(O)CC1CNCC1CC(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-[4-(Carboxymethyl)pyrrolidin-3-yl]acetic acid hydrochloride? |
| A: Molecular weight of 2-[4-(Carboxymethyl)pyrrolidin-3-yl]acetic acid hydrochloride is 223.65. |
| Q: What is the Chinese name of 2503205-73-8? |
| A: Chinese name of 2503205-73-8 is 2503205-73-8. |
| Q: What is the English name of 2-[4-(Carboxymethyl)pyrrolidin-3-yl]acetic acid hydrochloride? |
| A: The English name of 2-[4-(Carboxymethyl)pyrrolidin-3-yl]acetic acid hydrochloride is 2-[4-(Carboxymethyl)pyrrolidin-3-yl]acetic acid hydrochloride. |
| Q: What is the SMILES notation of 2-[4-(Carboxymethyl)pyrrolidin-3-yl]acetic acid hydrochloride? |
| A: SMILES notation of 2-[4-(Carboxymethyl)pyrrolidin-3-yl]acetic acid hydrochloride is Cl.O=C(O)CC1CNCC1CC(=O)O. |
| Q: What is the InChIKey of 2-[4-(Carboxymethyl)pyrrolidin-3-yl]acetic acid hydrochloride? |
| A: InChIKey of 2-[4-(Carboxymethyl)pyrrolidin-3-yl]acetic acid hydrochloride is MVPZEQHRILWQMC-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-[4-(Carboxymethyl)pyrrolidin-3-yl]acetic acid hydrochloride? |
| A: Molecular formula of 2-[4-(Carboxymethyl)pyrrolidin-3-yl]acetic acid hydrochloride is C8H14ClNO4. |
| Q: What is the CAS number of 2-[4-(Carboxymethyl)pyrrolidin-3-yl]acetic acid hydrochloride? |
| A: CAS number of 2-[4-(Carboxymethyl)pyrrolidin-3-yl]acetic acid hydrochloride is 2503205-73-8. |