[2-(1,1-Difluoroethyl)cyclopropyl]methanesulfonyl chloride
Modify Date: 2025-09-28 17:01:39
![[2-(1,1-Difluoroethyl)cyclopropyl]methanesulfonyl chloride Structure](https://www.chemsrc.com/extcaspic/249/2503206-72-0.png)
[2-(1,1-Difluoroethyl)cyclopropyl]methanesulfonyl chloride structure
|
Common Name | [2-(1,1-Difluoroethyl)cyclopropyl]methanesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 2503206-72-0 | Molecular Weight | 218.65 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H9ClF2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [2-(1,1-Difluoroethyl)cyclopropyl]methanesulfonyl chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H9ClF2O2S |
|---|---|
| Molecular Weight | 218.65 |
| InChIKey | YZJNPLJALAVPEP-UHFFFAOYSA-N |
| SMILES | CC(F)(F)C1CC1CS(=O)(=O)Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of [2-(1,1-Difluoroethyl)cyclopropyl]methanesulfonyl chloride? |
| A: InChIKey of [2-(1,1-Difluoroethyl)cyclopropyl]methanesulfonyl chloride is YZJNPLJALAVPEP-UHFFFAOYSA-N. |
| Q: What is the English name of [2-(1,1-Difluoroethyl)cyclopropyl]methanesulfonyl chloride? |
| A: The English name of [2-(1,1-Difluoroethyl)cyclopropyl]methanesulfonyl chloride is [2-(1,1-Difluoroethyl)cyclopropyl]methanesulfonyl chloride. |
| Q: What is the SMILES notation of [2-(1,1-Difluoroethyl)cyclopropyl]methanesulfonyl chloride? |
| A: SMILES notation of [2-(1,1-Difluoroethyl)cyclopropyl]methanesulfonyl chloride is CC(F)(F)C1CC1CS(=O)(=O)Cl. |
| Q: What is the CAS number of [2-(1,1-Difluoroethyl)cyclopropyl]methanesulfonyl chloride? |
| A: CAS number of [2-(1,1-Difluoroethyl)cyclopropyl]methanesulfonyl chloride is 2503206-72-0. |
| Q: What is the molecular formula of [2-(1,1-Difluoroethyl)cyclopropyl]methanesulfonyl chloride? |
| A: Molecular formula of [2-(1,1-Difluoroethyl)cyclopropyl]methanesulfonyl chloride is C6H9ClF2O2S. |
| Q: What is the Chinese name of 2503206-72-0? |
| A: Chinese name of 2503206-72-0 is 2503206-72-0. |
| Q: What is the molecular weight of [2-(1,1-Difluoroethyl)cyclopropyl]methanesulfonyl chloride? |
| A: Molecular weight of [2-(1,1-Difluoroethyl)cyclopropyl]methanesulfonyl chloride is 218.65. |