(2s,4s)-2-(Trifluoromethyl)-8-oxa-5-azaspiro[3.5]nonan-2-ol hydrochloride
Modify Date: 2025-08-29 18:17:51
![(2s,4s)-2-(Trifluoromethyl)-8-oxa-5-azaspiro[3.5]nonan-2-ol hydrochloride Structure](https://www.chemsrc.com/extcaspic/481/2503208-74-8.png)
(2s,4s)-2-(Trifluoromethyl)-8-oxa-5-azaspiro[3.5]nonan-2-ol hydrochloride structure
|
Common Name | (2s,4s)-2-(Trifluoromethyl)-8-oxa-5-azaspiro[3.5]nonan-2-ol hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2503208-74-8 | Molecular Weight | 247.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H13ClF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2s,4s)-2-(Trifluoromethyl)-8-oxa-5-azaspiro[3.5]nonan-2-ol hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H13ClF3NO2 |
|---|---|
| Molecular Weight | 247.64 |
| InChIKey | JFIGARLYLOZLDE-UHFFFAOYSA-N |
| SMILES | Cl.OC1(C(F)(F)F)CC2(COCCN2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (2s,4s)-2-(Trifluoromethyl)-8-oxa-5-azaspiro[3.5]nonan-2-ol hydrochloride? |
| A: Molecular formula of (2s,4s)-2-(Trifluoromethyl)-8-oxa-5-azaspiro[3.5]nonan-2-ol hydrochloride is C8H13ClF3NO2. |
| Q: What is the SMILES notation of (2s,4s)-2-(Trifluoromethyl)-8-oxa-5-azaspiro[3.5]nonan-2-ol hydrochloride? |
| A: SMILES notation of (2s,4s)-2-(Trifluoromethyl)-8-oxa-5-azaspiro[3.5]nonan-2-ol hydrochloride is Cl.OC1(C(F)(F)F)CC2(COCCN2)C1. |
| Q: What is the CAS number of (2s,4s)-2-(Trifluoromethyl)-8-oxa-5-azaspiro[3.5]nonan-2-ol hydrochloride? |
| A: CAS number of (2s,4s)-2-(Trifluoromethyl)-8-oxa-5-azaspiro[3.5]nonan-2-ol hydrochloride is 2503208-74-8. |
| Q: What is the Chinese name of 2503208-74-8? |
| A: Chinese name of 2503208-74-8 is 2503208-74-8. |
| Q: What is the English name of (2s,4s)-2-(Trifluoromethyl)-8-oxa-5-azaspiro[3.5]nonan-2-ol hydrochloride? |
| A: The English name of (2s,4s)-2-(Trifluoromethyl)-8-oxa-5-azaspiro[3.5]nonan-2-ol hydrochloride is (2s,4s)-2-(Trifluoromethyl)-8-oxa-5-azaspiro[3.5]nonan-2-ol hydrochloride. |
| Q: What is the molecular weight of (2s,4s)-2-(Trifluoromethyl)-8-oxa-5-azaspiro[3.5]nonan-2-ol hydrochloride? |
| A: Molecular weight of (2s,4s)-2-(Trifluoromethyl)-8-oxa-5-azaspiro[3.5]nonan-2-ol hydrochloride is 247.64. |
| Q: What is the InChIKey of (2s,4s)-2-(Trifluoromethyl)-8-oxa-5-azaspiro[3.5]nonan-2-ol hydrochloride? |
| A: InChIKey of (2s,4s)-2-(Trifluoromethyl)-8-oxa-5-azaspiro[3.5]nonan-2-ol hydrochloride is JFIGARLYLOZLDE-UHFFFAOYSA-N. |