2-benzofuran-1,3-dione,furan-2,5-dione,propane-1,2-diol structure
|
Common Name | 2-benzofuran-1,3-dione,furan-2,5-dione,propane-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 25037-66-5 | Molecular Weight | 322.26700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-benzofuran-1,3-dione,furan-2,5-dione,propane-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14O8 |
|---|---|
| Molecular Weight | 322.26700 |
| Exact Mass | 322.06900 |
| PSA | 127.20000 |
| InChIKey | URUNGZHBUGULCP-UHFFFAOYSA-N |
| SMILES | CC(O)CO.O=C1C=CC(=O)O1.O=C1OC(=O)c2ccccc21 |
| 1,3-Isobenzofurandione,polymer with 2,5-furandione and 1,2-propanediol |
| Phthalic anhydride,maleic anhydride,and propylene glycol polymer |