(4R,5R)-Dibenzyl 2-(2-(tert-butoxy)-2-oxoethyl)-1,3-dioxolane-4,5-dicarboxylate
Modify Date: 2026-07-03 16:04:21
(4R,5R)-Dibenzyl 2-(2-(tert-butoxy)-2-oxoethyl)-1,3-dioxolane-4,5-dicarboxylate structure
|
Common Name | (4R,5R)-Dibenzyl 2-(2-(tert-butoxy)-2-oxoethyl)-1,3-dioxolane-4,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 2504147-91-3 | Molecular Weight | 456.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H28O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4R,5R)-Dibenzyl 2-(2-(tert-butoxy)-2-oxoethyl)-1,3-dioxolane-4,5-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H28O8 |
|---|---|
| Molecular Weight | 456.5 |
| InChIKey | DSLWULUAASFFBM-FGZHOGPDSA-N |
| SMILES | CC(C)(C)OC(=O)CC1OC(C(=O)OCc2ccccc2)C(C(=O)OCc2ccccc2)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (4R,5R)-Dibenzyl 2-(2-(tert-butoxy)-2-oxoethyl)-1,3-dioxolane-4,5-dicarboxylate? |
| A: Molecular weight of (4R,5R)-Dibenzyl 2-(2-(tert-butoxy)-2-oxoethyl)-1,3-dioxolane-4,5-dicarboxylate is 456.5. |
| Q: What is the InChIKey of (4R,5R)-Dibenzyl 2-(2-(tert-butoxy)-2-oxoethyl)-1,3-dioxolane-4,5-dicarboxylate? |
| A: InChIKey of (4R,5R)-Dibenzyl 2-(2-(tert-butoxy)-2-oxoethyl)-1,3-dioxolane-4,5-dicarboxylate is DSLWULUAASFFBM-FGZHOGPDSA-N. |
| Q: What is the molecular formula of (4R,5R)-Dibenzyl 2-(2-(tert-butoxy)-2-oxoethyl)-1,3-dioxolane-4,5-dicarboxylate? |
| A: Molecular formula of (4R,5R)-Dibenzyl 2-(2-(tert-butoxy)-2-oxoethyl)-1,3-dioxolane-4,5-dicarboxylate is C25H28O8. |
| Q: What is the Chinese name of 2504147-91-3? |
| A: Chinese name of 2504147-91-3 is 2504147-91-3. |
| Q: What is the CAS number of (4R,5R)-Dibenzyl 2-(2-(tert-butoxy)-2-oxoethyl)-1,3-dioxolane-4,5-dicarboxylate? |
| A: CAS number of (4R,5R)-Dibenzyl 2-(2-(tert-butoxy)-2-oxoethyl)-1,3-dioxolane-4,5-dicarboxylate is 2504147-91-3. |
| Q: What is the SMILES notation of (4R,5R)-Dibenzyl 2-(2-(tert-butoxy)-2-oxoethyl)-1,3-dioxolane-4,5-dicarboxylate? |
| A: SMILES notation of (4R,5R)-Dibenzyl 2-(2-(tert-butoxy)-2-oxoethyl)-1,3-dioxolane-4,5-dicarboxylate is CC(C)(C)OC(=O)CC1OC(C(=O)OCc2ccccc2)C(C(=O)OCc2ccccc2)O1. |
| Q: What is the English name of (4R,5R)-Dibenzyl 2-(2-(tert-butoxy)-2-oxoethyl)-1,3-dioxolane-4,5-dicarboxylate? |
| A: The English name of (4R,5R)-Dibenzyl 2-(2-(tert-butoxy)-2-oxoethyl)-1,3-dioxolane-4,5-dicarboxylate is (4R,5R)-Dibenzyl 2-(2-(tert-butoxy)-2-oxoethyl)-1,3-dioxolane-4,5-dicarboxylate. |