1-[3-Fluoro-4-(2,2,2-trifluoro-ethoxy)-phenyl]-ethylamine; hydrochloride
Modify Date: 2026-09-12 13:30:51
![1-[3-Fluoro-4-(2,2,2-trifluoro-ethoxy)-phenyl]-ethylamine; hydrochloride Structure](https://www.chemsrc.com/extcaspic/123/2504203-60-3.png)
1-[3-Fluoro-4-(2,2,2-trifluoro-ethoxy)-phenyl]-ethylamine; hydrochloride structure
|
Common Name | 1-[3-Fluoro-4-(2,2,2-trifluoro-ethoxy)-phenyl]-ethylamine; hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2504203-60-3 | Molecular Weight | 273.65 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12ClF4NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[3-Fluoro-4-(2,2,2-trifluoro-ethoxy)-phenyl]-ethylamine; hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12ClF4NO |
|---|---|
| Molecular Weight | 273.65 |
| InChIKey | WQTFKLJHPDCVPI-UHFFFAOYSA-N |
| SMILES | CC(N)c1ccc(OCC(F)(F)F)c(F)c1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-[3-Fluoro-4-(2,2,2-trifluoro-ethoxy)-phenyl]-ethylamine; hydrochloride? |
| A: Molecular formula of 1-[3-Fluoro-4-(2,2,2-trifluoro-ethoxy)-phenyl]-ethylamine; hydrochloride is C10H12ClF4NO. |
| Q: What is the English name of 1-[3-Fluoro-4-(2,2,2-trifluoro-ethoxy)-phenyl]-ethylamine; hydrochloride? |
| A: The English name of 1-[3-Fluoro-4-(2,2,2-trifluoro-ethoxy)-phenyl]-ethylamine; hydrochloride is 1-[3-Fluoro-4-(2,2,2-trifluoro-ethoxy)-phenyl]-ethylamine; hydrochloride. |
| Q: What is the Chinese name of 2504203-60-3? |
| A: Chinese name of 2504203-60-3 is 2504203-60-3. |
| Q: What is the molecular weight of 1-[3-Fluoro-4-(2,2,2-trifluoro-ethoxy)-phenyl]-ethylamine; hydrochloride? |
| A: Molecular weight of 1-[3-Fluoro-4-(2,2,2-trifluoro-ethoxy)-phenyl]-ethylamine; hydrochloride is 273.65. |
| Q: What is the InChIKey of 1-[3-Fluoro-4-(2,2,2-trifluoro-ethoxy)-phenyl]-ethylamine; hydrochloride? |
| A: InChIKey of 1-[3-Fluoro-4-(2,2,2-trifluoro-ethoxy)-phenyl]-ethylamine; hydrochloride is WQTFKLJHPDCVPI-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-[3-Fluoro-4-(2,2,2-trifluoro-ethoxy)-phenyl]-ethylamine; hydrochloride? |
| A: CAS number of 1-[3-Fluoro-4-(2,2,2-trifluoro-ethoxy)-phenyl]-ethylamine; hydrochloride is 2504203-60-3. |
| Q: What is the SMILES notation of 1-[3-Fluoro-4-(2,2,2-trifluoro-ethoxy)-phenyl]-ethylamine; hydrochloride? |
| A: SMILES notation of 1-[3-Fluoro-4-(2,2,2-trifluoro-ethoxy)-phenyl]-ethylamine; hydrochloride is CC(N)c1ccc(OCC(F)(F)F)c(F)c1.Cl. |