1-(3-Bromo-5-trifluoromethyl-phenoxymethyl)-cyclopropylamine hydrochloride
Modify Date: 2026-07-22 21:37:31
1-(3-Bromo-5-trifluoromethyl-phenoxymethyl)-cyclopropylamine hydrochloride structure
|
Common Name | 1-(3-Bromo-5-trifluoromethyl-phenoxymethyl)-cyclopropylamine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2504204-07-1 | Molecular Weight | 346.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12BrClF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3-Bromo-5-trifluoromethyl-phenoxymethyl)-cyclopropylamine hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12BrClF3NO |
|---|---|
| Molecular Weight | 346.57 |
| InChIKey | DBQMALWCIIZHBT-UHFFFAOYSA-N |
| SMILES | Cl.NC1(COc2cc(Br)cc(C(F)(F)F)c2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-(3-Bromo-5-trifluoromethyl-phenoxymethyl)-cyclopropylamine hydrochloride? |
| A: SMILES notation of 1-(3-Bromo-5-trifluoromethyl-phenoxymethyl)-cyclopropylamine hydrochloride is Cl.NC1(COc2cc(Br)cc(C(F)(F)F)c2)CC1. |
| Q: What is the Chinese name of 2504204-07-1? |
| A: Chinese name of 2504204-07-1 is 2504204-07-1. |
| Q: What is the molecular weight of 1-(3-Bromo-5-trifluoromethyl-phenoxymethyl)-cyclopropylamine hydrochloride? |
| A: Molecular weight of 1-(3-Bromo-5-trifluoromethyl-phenoxymethyl)-cyclopropylamine hydrochloride is 346.57. |
| Q: What is the InChIKey of 1-(3-Bromo-5-trifluoromethyl-phenoxymethyl)-cyclopropylamine hydrochloride? |
| A: InChIKey of 1-(3-Bromo-5-trifluoromethyl-phenoxymethyl)-cyclopropylamine hydrochloride is DBQMALWCIIZHBT-UHFFFAOYSA-N. |
| Q: What is the English name of 1-(3-Bromo-5-trifluoromethyl-phenoxymethyl)-cyclopropylamine hydrochloride? |
| A: The English name of 1-(3-Bromo-5-trifluoromethyl-phenoxymethyl)-cyclopropylamine hydrochloride is 1-(3-Bromo-5-trifluoromethyl-phenoxymethyl)-cyclopropylamine hydrochloride. |
| Q: What is the molecular formula of 1-(3-Bromo-5-trifluoromethyl-phenoxymethyl)-cyclopropylamine hydrochloride? |
| A: Molecular formula of 1-(3-Bromo-5-trifluoromethyl-phenoxymethyl)-cyclopropylamine hydrochloride is C11H12BrClF3NO. |
| Q: What is the CAS number of 1-(3-Bromo-5-trifluoromethyl-phenoxymethyl)-cyclopropylamine hydrochloride? |
| A: CAS number of 1-(3-Bromo-5-trifluoromethyl-phenoxymethyl)-cyclopropylamine hydrochloride is 2504204-07-1. |