Elenestinib structure
|
Common Name | Elenestinib | ||
|---|---|---|---|---|
| CAS Number | 2505078-08-8 | Molecular Weight | 528.58 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H29FN10O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ElenestinibElenestinib (BLU-263) is a potent and orally active tyrosine kinase inhibitor. Elenestinib has the potential for the research of systemic mastocytosis (SM)[1]. |
| Name | Elenestinib |
|---|
| Description | Elenestinib (BLU-263) is a potent and orally active tyrosine kinase inhibitor. Elenestinib has the potential for the research of systemic mastocytosis (SM)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C27H29FN10O |
|---|---|
| Molecular Weight | 528.58 |
| InChIKey | IPMARPMXSFFZFG-MHZLTWQESA-N |
| SMILES | CC(N)(c1ccc(F)cc1)c1cnc(N2CCN(c3ncnn4cc(-c5cnn(CCO)c5)cc34)CC2)nc1 |