Benzeneacetonitrile, a-nitro- structure
|
Common Name | Benzeneacetonitrile, a-nitro- | ||
|---|---|---|---|---|
| CAS Number | 25059-43-2 | Molecular Weight | 162.14500 | |
| Density | 1.255g/cm3 | Boiling Point | 266.3ºC at 760 mmHg | |
| Molecular Formula | C8H6N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.8ºC | |
| Name | 2-nitro-2-phenylacetonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 266.3ºC at 760 mmHg |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.14500 |
| Flash Point | 114.8ºC |
| Exact Mass | 162.04300 |
| PSA | 69.61000 |
| LogP | 2.05118 |
| Vapour Pressure | 0.00873mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | DBMPHBQSQZZRDP-UHFFFAOYSA-N |
| SMILES | N#CC(c1ccccc1)[N+](=O)[O-] |
|
~%
Benzeneacetonit... CAS#:25059-43-2 |
| Literature: Thurston; Shriner Journal of Organic Chemistry, 1937 , vol. 2, p. 183,191 |
|
~%
Benzeneacetonit... CAS#:25059-43-2 |
| Literature: Thurston; Shriner Journal of Organic Chemistry, 1937 , vol. 2, p. 183,191 |
|
~%
Benzeneacetonit... CAS#:25059-43-2 |
| Literature: Wieland; Hoechtlen Justus Liebigs Annalen der Chemie, 1933 , vol. 505, p. 237,240 |
| Precursor 5 | |
|---|---|
| DownStream 9 | |
| Acetonitrile,nitrophenyl |
| Phenylcyannitromethan |
| 2-nitro-2-phenyl-ethanenitrile |
| nitro-phenyl-acetonitrile |