4H-1-Benzopyran-4-one,6-chloro-2-(2-quinolinyl)- structure
|
Common Name | 4H-1-Benzopyran-4-one,6-chloro-2-(2-quinolinyl)- | ||
|---|---|---|---|---|
| CAS Number | 2508-13-6 | Molecular Weight | 307.73100 | |
| Density | 1.407g/cm3 | Boiling Point | 510.5ºC at 760 mmHg | |
| Molecular Formula | C18H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.5ºC | |
| Name | 6-chloro-2-quinolin-2-ylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.407g/cm3 |
|---|---|
| Boiling Point | 510.5ºC at 760 mmHg |
| Molecular Formula | C18H10ClNO2 |
| Molecular Weight | 307.73100 |
| Flash Point | 262.5ºC |
| Exact Mass | 307.04000 |
| PSA | 43.10000 |
| LogP | 4.66160 |
| Vapour Pressure | 1.54E-10mmHg at 25°C |
| Index of Refraction | 1.706 |
| InChIKey | GAPZLCOEGUSIPQ-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccc3ccccc3n2)oc2ccc(Cl)cc12 |
|
~%
4H-1-Benzopyran... CAS#:2508-13-6 |
| Literature: Donnelly,D. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 872 - 875 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 6-chloro-2-quinolin-2-yl-chromen-4-one |