Phosphinic acid,(1,1-dimethylethyl)[4-(1,1-dimethylethyl)phenyl]- (9CI) structure
|
Common Name | Phosphinic acid,(1,1-dimethylethyl)[4-(1,1-dimethylethyl)phenyl]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 25097-42-1 | Molecular Weight | 254.30500 | |
| Density | 1.03g/cm3 | Boiling Point | 405.4ºC at 760 mmHg | |
| Molecular Formula | C14H23O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199ºC | |
| Name | tert-butyl-(4-tert-butylphenyl)phosphinic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 405.4ºC at 760 mmHg |
| Molecular Formula | C14H23O2P |
| Molecular Weight | 254.30500 |
| Flash Point | 199ºC |
| Exact Mass | 254.14400 |
| PSA | 47.11000 |
| LogP | 3.67830 |
| Vapour Pressure | 2.68E-07mmHg at 25°C |
| Index of Refraction | 1.499 |
| InChIKey | TVQBXSAUENTUMA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(P(=O)(O)C(C)(C)C)cc1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Phosphinic acid,tert-butyl(p-tert-butylphenyl) |
| tert-Butyl(4-tert-butylphenyl)phosphinic acid |
| phosphinic acid,(1,1-dimethylethyl)[4-(1,1-dimethylethyl)phenyl] |
| p-tert.Butylphenyl-tert.butylphosphinsaeure |