2-[(4-iodophenyl)methyl]propanedioic acid structure
|
Common Name | 2-[(4-iodophenyl)methyl]propanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 25100-55-4 | Molecular Weight | 320.08100 | |
| Density | 1.917g/cm3 | Boiling Point | 431.8ºC at 760mmHg | |
| Molecular Formula | C10H9IO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.9ºC | |
| Name | 2-[(4-iodophenyl)methyl]propanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.917g/cm3 |
|---|---|
| Boiling Point | 431.8ºC at 760mmHg |
| Molecular Formula | C10H9IO4 |
| Molecular Weight | 320.08100 |
| Flash Point | 214.9ºC |
| Exact Mass | 319.95500 |
| PSA | 74.60000 |
| LogP | 1.61910 |
| Vapour Pressure | 3.2E-08mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | SFNPFIRJKDCDGR-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Cc1ccc(I)cc1)C(=O)O |
|
~%
2-[(4-iodopheny... CAS#:25100-55-4 |
| Literature: Strain; Plati; Warren Journal of the American Chemical Society, 1942 , vol. 64, p. 1436,1438 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| (4-iodobenzyl)propanedioic acid |
| (4-Jod-benzyl)-malonsaeure |
| Iodobenzylmalonate |
| (4-iodo-benzyl)-malonic acid |
| 2-(4-Iodobenzyl)malonic acid |