1-chloro-1,2,2-trifluoroethene,1,1-difluoroethene,1,1,2,3,3,3-hexafluoroprop-1-ene structure
|
Common Name | 1-chloro-1,2,2-trifluoroethene,1,1-difluoroethene,1,1,2,3,3,3-hexafluoroprop-1-ene | ||
|---|---|---|---|---|
| CAS Number | 25101-47-7 | Molecular Weight | 330.52600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H2ClF11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-1,2,2-trifluoroethene,1,1-difluoroethene,1,1,2,3,3,3-hexafluoroprop-1-ene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H2ClF11 |
|---|---|
| Molecular Weight | 330.52600 |
| Exact Mass | 329.96700 |
| LogP | 6.28320 |
| InChIKey | CJJMXEVOMLWYEB-UHFFFAOYSA-N |
| SMILES | C=C(F)F.FC(F)=C(F)C(F)(F)F.FC(F)=C(F)Cl |
| Vinylidene fluoride,hexafluoropropylene,chlorotrifluoroethene polymer |
| 1-Propene,1,1,2,3,3,3-hexafluoro-,polymer with chlorotrifluoroethene and 1,1-difluoroethene |
| 1-chloro-1,2,2-trifluoro-ethylene |