(2E)-3-{3-[(Dimethylamino)methyl]-4-methoxyphenyl}acrylic acid
Modify Date: 2025-08-26 11:44:58
![(2E)-3-{3-[(Dimethylamino)methyl]-4-methoxyphenyl}acrylic acid Structure](https://image.chemsrc.com/caspic/473/251111-38-3.png)
(2E)-3-{3-[(Dimethylamino)methyl]-4-methoxyphenyl}acrylic acid structure
|
Common Name | (2E)-3-{3-[(Dimethylamino)methyl]-4-methoxyphenyl}acrylic acid | ||
|---|---|---|---|---|
| CAS Number | 251111-38-3 | Molecular Weight | 235.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2E)-3-{3-[(Dimethylamino)methyl]-4-methoxyphenyl}acrylic acid |
|---|
| Molecular Formula | C13H17NO3 |
|---|---|
| Molecular Weight | 235.27900 |
| Exact Mass | 235.12100 |
| PSA | 49.77000 |
| LogP | 1.85460 |
| InChIKey | UJBHNCBRCWQMAD-FNORWQNLSA-N |
| SMILES | COc1ccc(C=CC(=O)O)cc1CN(C)C |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |