3(2H)-Pyridazinone,4-chloro-5-methoxy-2-phenyl- structure
|
Common Name | 3(2H)-Pyridazinone,4-chloro-5-methoxy-2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 2514-18-3 | Molecular Weight | 236.65400 | |
| Density | 1.31g/cm3 | Boiling Point | 366.8ºC at 760mmHg | |
| Molecular Formula | C11H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.6ºC | |
| Name | 4-chloro-5-methoxy-2-phenylpyridazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 366.8ºC at 760mmHg |
| Molecular Formula | C11H9ClN2O2 |
| Molecular Weight | 236.65400 |
| Flash Point | 175.6ºC |
| Exact Mass | 236.03500 |
| PSA | 44.12000 |
| LogP | 1.89450 |
| Vapour Pressure | 1.43E-05mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | RSTBYGMJEKPLBW-UHFFFAOYSA-N |
| SMILES | COc1cnn(-c2ccccc2)c(=O)c1Cl |
| Storage condition | 2-8°C |
|
~%
3(2H)-Pyridazin... CAS#:2514-18-3 |
| Literature: Abbott Laboratories Patent: US6307047 B1, 2001 ; |
|
~68%
3(2H)-Pyridazin... CAS#:2514-18-3 |
| Literature: Kim, Jeum-Jong; Park, Yong-Dae; Cho, Su-Dong; Kim, Ho-Kyun; Chung, Hyun A.; Lee, Sang-Gyeong; Falck; Yoon, Yong-Jin Tetrahedron Letters, 2004 , vol. 45, # 48 p. 8781 - 8784 |
|
~91%
3(2H)-Pyridazin... CAS#:2514-18-3 |
| Literature: Lyga, John W. Journal of Heterocyclic Chemistry, 1988 , vol. 25, p. 1757 - 1760 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 4-chloro-5-methoxy-2-phenylpyridazin-3(2H)-one |
| 2-phenyl-4-chloro-5-methoxy-3(2H)-pyridazinone |
| 4-chloro-5-methoxy-2-phenyl-2H-pyridazin-3-one |
| 2-phenyl-4-chloro-5-methoxypyridazin-3-one |
| 8M-543S |
| 4-Chloro-5-methoxy-2-phenyl-3(2H)-pyridazinone |