(3S)-tert-Butyldimethylsilyl Vitamin D2 SO2 Adduct (Mixture of Diastereomers) structure
|
Common Name | (3S)-tert-Butyldimethylsilyl Vitamin D2 SO2 Adduct (Mixture of Diastereomers) | ||
|---|---|---|---|---|
| CAS Number | 251445-16-6 | Molecular Weight | 574.97300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H58O3SSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(5S)-3-[(E)-[(1R,3aS,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]methyl]-2,2-dioxo-1,3,4,5,6,7-hexahydro-2-benzothiophen-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C34H58O3SSi |
|---|---|
| Molecular Weight | 574.97300 |
| Exact Mass | 574.38800 |
| PSA | 51.75000 |
| LogP | 10.36230 |
| InChIKey | ISXKXFGJQNACAU-NYGAKBRBSA-N |
| SMILES | CC(C)C(C)C=CC(C)C1CCC2C(=CC3C4=C(CCC(O[Si](C)(C)C(C)(C)C)C4)CS3(=O)=O)CCCC21C |
| (3S)-tert-Butyldimethylsilyl Vitamin D2 SO2 Adduct (Mixture of Diastereomers) |
| (1,1-Dimethylethyl)dimethyl[[(1|A,7E,22E)-6,19-sulfonyl-9,10-secoergosta-5(10),7,22-trien-3-yl]oxy]silane |