1-(2,5-Diethoxyphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione
Modify Date: 2026-07-16 12:49:14
1-(2,5-Diethoxyphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione structure
|
Common Name | 1-(2,5-Diethoxyphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione | ||
|---|---|---|---|---|
| CAS Number | 251468-85-6 | Molecular Weight | 292.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2,5-Diethoxyphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H16N2O5 |
|---|---|
| Molecular Weight | 292.29 |
| InChIKey | QVSWVNGLYPELBA-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(OCC)c(N2C(=O)CC(=O)NC2=O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-(2,5-Diethoxyphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione? |
| A: Molecular weight of 1-(2,5-Diethoxyphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione is 292.29. |
| Q: What is the Chinese name of 251468-85-6? |
| A: Chinese name of 251468-85-6 is 251468-85-6. |
| Q: What is the InChIKey of 1-(2,5-Diethoxyphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione? |
| A: InChIKey of 1-(2,5-Diethoxyphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione is QVSWVNGLYPELBA-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-(2,5-Diethoxyphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione? |
| A: SMILES notation of 1-(2,5-Diethoxyphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione is CCOc1ccc(OCC)c(N2C(=O)CC(=O)NC2=O)c1. |
| Q: What is the CAS number of 1-(2,5-Diethoxyphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione? |
| A: CAS number of 1-(2,5-Diethoxyphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione is 251468-85-6. |
| Q: What is the molecular formula of 1-(2,5-Diethoxyphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione? |
| A: Molecular formula of 1-(2,5-Diethoxyphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione is C14H16N2O5. |
| Q: What is the English name of 1-(2,5-Diethoxyphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione? |
| A: The English name of 1-(2,5-Diethoxyphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione is 1-(2,5-Diethoxyphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione. |