Phenol,4-(4,5-dihydro-1,5-diphenyl-1H-pyrazol-3-yl)- structure
|
Common Name | Phenol,4-(4,5-dihydro-1,5-diphenyl-1H-pyrazol-3-yl)- | ||
|---|---|---|---|---|
| CAS Number | 2515-57-3 | Molecular Weight | 314.38000 | |
| Density | 1.224g/cm3 | Boiling Point | 467.1ºC at 760mmHg | |
| Molecular Formula | C21H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.3ºC | |
| Name | 4-(1,5-diphenylpyrazolidin-3-ylidene)cyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.224g/cm3 |
|---|---|
| Boiling Point | 467.1ºC at 760mmHg |
| Molecular Formula | C21H18N2O |
| Molecular Weight | 314.38000 |
| Flash Point | 236.3ºC |
| Exact Mass | 314.14200 |
| PSA | 35.83000 |
| LogP | 4.24850 |
| Vapour Pressure | 6.7E-09mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | QFAHQNWUNXVQES-UHFFFAOYSA-N |
| SMILES | Oc1ccc(C2=NN(c3ccccc3)C(c3ccccc3)C2)cc1 |
|
~41%
Phenol,4-(4,5-d... CAS#:2515-57-3 |
| Literature: Li, Pei-Ze; Liu, Zai-Qun Tetrahedron, 2013 , vol. 69, # 46 p. 9898 - 9905 |
|
~%
Phenol,4-(4,5-d... CAS#:2515-57-3 |
| Literature: Raiford; Peterson Journal of Organic Chemistry, 1936 , vol. 1, p. 544,550 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-<4-Hydroxy-phenyl>-1,5-diphenyl-pyrazolin |