polysulfone structure
|
Common Name | polysulfone | ||
|---|---|---|---|---|
| CAS Number | 25154-01-2 | Molecular Weight | 515.44800 | |
| Density | 1.24 g/mL at 25 °C(lit.) | Boiling Point | 400.8ºC at 760 mmHg | |
| Molecular Formula | C27H24Cl2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.4ºC | |
| Name | 1-chloro-4-(4-chlorophenyl)sulfonylbenzene,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
|---|
| Density | 1.24 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 400.8ºC at 760 mmHg |
| Molecular Formula | C27H24Cl2O4S |
| Molecular Weight | 515.44800 |
| Flash Point | 192.4ºC |
| Exact Mass | 514.07700 |
| PSA | 82.98000 |
| LogP | 8.33070 |
| Appearance of Characters | pellets |
| Vapour Pressure | 5.34E-07mmHg at 25°C |
| Index of Refraction | n20/D 1.633 |
| InChIKey | IQNPTYXQCJVNHR-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.O=S(=O)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| WGK Germany | 3 |
|---|