1-tert-butyl 2-ethyl 5-oxopyrrolidine-1,2-dicarboxylate
Modify Date: 2025-08-25 19:44:43
1-tert-butyl 2-ethyl 5-oxopyrrolidine-1,2-dicarboxylate structure
|
Common Name | 1-tert-butyl 2-ethyl 5-oxopyrrolidine-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 251924-83-1 | Molecular Weight | 257.28300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 1-tert-butyl 2-ethyl 5-oxopyrrolidine-1,2-dicarboxylate1-Boc-DL-Pyroglutamic acid ethyl ester is a Boc-protected Pyroglutamic acid derivative, can be used for the synthesis of drugs or other compounds[1]. |
| Name | 1-tert-butoxycarbonyl-2-ethyl-5-oxo-pyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 1-Boc-DL-Pyroglutamic acid ethyl ester is a Boc-protected Pyroglutamic acid derivative, can be used for the synthesis of drugs or other compounds[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C12H19NO5 |
|---|---|
| Molecular Weight | 257.28300 |
| Exact Mass | 257.12600 |
| PSA | 83.91000 |
| LogP | 1.71520 |
| InChIKey | YWWWGFSJHCFVOW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCC(=O)N1C(=O)OC(C)(C)C |
| MFCD04113945 |