4-imino-1-(4-methoxyphenyl)-3-phenyl-5-sulfanylideneimidazolidin-2-one structure
|
Common Name | 4-imino-1-(4-methoxyphenyl)-3-phenyl-5-sulfanylideneimidazolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 252004-99-2 | Molecular Weight | 311.35800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-imino-1-(4-methoxyphenyl)-3-phenyl-5-sulfanylideneimidazolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H13N3O2S |
|---|---|
| Molecular Weight | 311.35800 |
| Exact Mass | 311.07300 |
| PSA | 88.72000 |
| LogP | 3.67620 |
| InChIKey | OKOOAWSEDDGVFM-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2C(=O)N(c3ccccc3)C(=N)C2=S)cc1 |
|
~75%
4-imino-1-(4-me... CAS#:252004-99-2 |
| Literature: El-Sharief; Ammar; Mohamed; Aly; El-Gaby Phosphorus, Sulfur and Silicon and Related Elements, 2001 , vol. 173, p. 39 - 58 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Imidazolidinone,4-imino-1-(4-methoxyphenyl)-3-phenyl-5-thioxo |
| 4-imino-1-(4-methoxyphenyl)-3-phenyl-5-thioxo-2-imidazolidinone |