Fmoc-N-Me-Nva-OH structure
|
Common Name | Fmoc-N-Me-Nva-OH | ||
|---|---|---|---|---|
| CAS Number | 252049-05-1 | Molecular Weight | 353.412 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 533.1±29.0 °C at 760 mmHg | |
| Molecular Formula | C21H23NO4 | Melting Point | 130.0 to 135.0 °C | |
| MSDS | N/A | Flash Point | 276.2±24.3 °C | |
| Name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 533.1±29.0 °C at 760 mmHg |
| Melting Point | 130.0 to 135.0 °C |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.412 |
| Flash Point | 276.2±24.3 °C |
| Exact Mass | 353.162720 |
| PSA | 66.84000 |
| LogP | 5.09 |
| Appearance of Characters | Solid |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | HKELUUGCKFRJQM-IBGZPJMESA-N |
| SMILES | CCCC(C(=O)O)N(C)C(=O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | Store at RT. |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| TMA050 |
| Fmoc-N-methyl-L-norvaline |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-methyl-L-norvaline |
| L-Norvaline, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-N-methyl- |
| L-Norvaline,N-[(9H-fluoren-9-ylmethoxy)carbonyl]-N-methyl |
| (2S)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl](methyl)amino}pentanoic acid |
| Fmoc-N-Me-Nva-OH |