Fmoc-His(3-Me)-OH structure
|
Common Name | Fmoc-His(3-Me)-OH | ||
|---|---|---|---|---|
| CAS Number | 252049-16-4 | Molecular Weight | 391.42000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H21N3O4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of Fmoc-His(3-Me)-OHFmoc-His(3-Me)OH derives Histidine-associating compounds with biological activity. Fmoc-His(3-Me)OH, with Fmoc-citrulline-OH, Fmoc-His(1-Me)-OH together, forms tri-peptides and shows vasodilating effect with EC50s of 2.7-4.7 mM in 1.0 mM Phenylephrine (PE)-contracted aorta rings. Fmoc-His(3-Me)OH (resin) also makes Methyl-His-Gly-Lys (His(3-Me)-Gly-Lys), thus acts as an [Ca2+]i inhibitor. Fmoc-His(3-Me)OH methylates NAHIS02, making it unable to block the Alzheimer's Aβ channel[1][2][3]. |
| Name | fmoc-his(3-me)-oh |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-His(3-Me)OH derives Histidine-associating compounds with biological activity. Fmoc-His(3-Me)OH, with Fmoc-citrulline-OH, Fmoc-His(1-Me)-OH together, forms tri-peptides and shows vasodilating effect with EC50s of 2.7-4.7 mM in 1.0 mM Phenylephrine (PE)-contracted aorta rings. Fmoc-His(3-Me)OH (resin) also makes Methyl-His-Gly-Lys (His(3-Me)-Gly-Lys), thus acts as an [Ca2+]i inhibitor. Fmoc-His(3-Me)OH methylates NAHIS02, making it unable to block the Alzheimer's Aβ channel[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C22H21N3O4 |
|---|---|
| Molecular Weight | 391.42000 |
| Exact Mass | 391.15300 |
| PSA | 93.45000 |
| LogP | 3.34540 |
| InChIKey | UEDYXEZHNPXCFB-FQEVSTJZSA-N |
| SMILES | Cn1cncc1CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| FMOC-HISTIDINE(3-ME)-OH |
| N-(9-FLUORENYLMETHOXYCARBONYL)-N-IMIDAZOLE-3-METHYL-L-HISTIDINE |
| Fmoc-His(p-Me)-OH |
| FMOC-N-P-METHYL-L-HISTIDINE |