3-Chloro-2,2-diphenyl-propanoic acid structure
|
Common Name | 3-Chloro-2,2-diphenyl-propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 25209-42-1 | Molecular Weight | 260.71600 | |
| Density | 1.249g/cm3 | Boiling Point | 330.6ºC at 760mmHg | |
| Molecular Formula | C15H13ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-chloro-2,2-diphenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 330.6ºC at 760mmHg |
| Molecular Formula | C15H13ClO2 |
| Molecular Weight | 260.71600 |
| Exact Mass | 260.06000 |
| PSA | 37.30000 |
| LogP | 3.29610 |
| Vapour Pressure | 6.59E-05mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | XOXPNTBLXHWKGZ-UHFFFAOYSA-N |
| SMILES | O=C(O)C(CCl)(c1ccccc1)c1ccccc1 |
|
~%
3-Chloro-2,2-di... CAS#:25209-42-1 |
| Literature: Zaugg; Horrom Journal of the American Chemical Society, 1950 , vol. 72, p. 3004,3005 |
| 3-Chlor-2,2-diphenyl-propionsaeure |
| 3-chloro-2,2-diphenyl-propanoic acid |
| 3-chloro-2,2-diphenyl-propionic acid |