Etidronic acid 1-hydrate structure
|
Common Name | Etidronic acid 1-hydrate | ||
|---|---|---|---|---|
| CAS Number | 25211-86-3 | Molecular Weight | 224.04400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C2H10O8P2 | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | N/A | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | (1-hydroxy-1-phosphonoethyl)phosphonic acid,hydrate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C2H10O8P2 |
|---|---|
| Molecular Weight | 224.04400 |
| Exact Mass | 223.98500 |
| PSA | 164.14000 |
| InChIKey | KKNZXUHBWLPUFN-UHFFFAOYSA-N |
| SMILES | CC(O)(P(=O)(O)O)P(=O)(O)O.O |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H318-H413 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Hazard Codes | Xn |
| RIDADR | UN 3082 9 / PGIII |
| RTECS | SZ8562100 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
L. Maier
Chimia 23 , 323, (1969)
|
| 1-Hydroxyethylidene-1,1-diphosphonic acid monohydrate |
| 1-hydroxyethane-1,1-diphosphonic acid monohydrate |
| ethane-1-hydroxy-1,1-diphosphonic acid monohydrate |
| Etidronic acid monohydrate |
| hydroxyethylidene bisphosphonic acid monohydrate |
| Hydroxyethylidene diphosphonic acid monohydrate |
| 1-hydroxyethylidenediphosphonic acid monohydrate |