(Z)-4-butoxy-4-oxobut-2-enoic acid,styrene structure
|
Common Name | (Z)-4-butoxy-4-oxobut-2-enoic acid,styrene | ||
|---|---|---|---|---|
| CAS Number | 25215-62-7 | Molecular Weight | 276.32800 | |
| Density | N/A | Boiling Point | 289.1ºC at 760mmHg | |
| Molecular Formula | C16H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.9ºC | |
| Name | (Z)-4-butoxy-4-oxobut-2-enoic acid,styrene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 289.1ºC at 760mmHg |
|---|---|
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.32800 |
| Flash Point | 113.9ºC |
| Exact Mass | 276.13600 |
| PSA | 63.60000 |
| LogP | 3.30010 |
| InChIKey | AAFCVNRTKWSHAI-MKWAYWHRSA-N |
| SMILES | C=Cc1ccccc1.CCCCOC(=O)C=CC(=O)O |
| 2-Butenedioic acid (2Z)-,1-butyl ester,polymer with ethenylbenzene |
| 2-Butenedioic acid (2Z)-,monobutyl ester,polymer with ethenylbenzene |
| 2-Butenedioic acid (Z)-,monobutyl ester,polymer with ethenylbenzene |
| Butyl maleate,styrene polymer |