2-chloroethyl N-(3,5-dichlorophenyl)carbamate structure
|
Common Name | 2-chloroethyl N-(3,5-dichlorophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 25217-44-1 | Molecular Weight | 268.52400 | |
| Density | 1.486g/cm3 | Boiling Point | 310.2ºC at 760 mmHg | |
| Molecular Formula | C9H8Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.4ºC | |
| Name | 2-chloroethyl N-(3,5-dichlorophenyl)carbamate |
|---|
| Density | 1.486g/cm3 |
|---|---|
| Boiling Point | 310.2ºC at 760 mmHg |
| Molecular Formula | C9H8Cl3NO2 |
| Molecular Weight | 268.52400 |
| Flash Point | 141.4ºC |
| Exact Mass | 266.96200 |
| PSA | 38.33000 |
| LogP | 3.85370 |
| Vapour Pressure | 0.000607mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | SVWSZECXBGWSPN-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)OCCCl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |