phenacyl 2,2-dimethylpropanoate structure
|
Common Name | phenacyl 2,2-dimethylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 2522-81-8 | Molecular Weight | 220.26400 | |
| Density | 1.063g/cm3 | Boiling Point | 306.9ºC at 760mmHg | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.5ºC | |
| Name | phenacyl 2,2-dimethylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.063g/cm3 |
|---|---|
| Boiling Point | 306.9ºC at 760mmHg |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.26400 |
| Flash Point | 131.5ºC |
| Exact Mass | 220.11000 |
| PSA | 43.37000 |
| LogP | 2.45860 |
| Vapour Pressure | 0.000749mmHg at 25°C |
| Index of Refraction | 1.502 |
| InChIKey | OTIZTAXUFMCICV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OCC(=O)c1ccccc1 |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Pibecarbum [INN-Latin] |
| Pibecarbe [INN-French] |
| 2,2-dimethyl-propionic acid 2-oxo-2-pheny-ethyl ester |
| phenacyl trimethylacetate |
| 2-oxo-2-phenylethyl pivalate |
| Pibecarb |
| Pivalic acid,ester with 2-hydroxyacetophenone |
| (pivaloyloxy)methyl phenyl ketone |
| trimethylacetic acid 2-oxo-2-phenylethyl ester |
| Pibecarbo [INN-Spanish] |
| 2-<(2,2-dimethylpropanoyl)oxy>-1-phenylethanone |
| Phenacylpivalate |
| Benzoylcarbinyl trimethylacetate |
| EINECS 219-749-1 |
| Benzoylcarbinol trimethylacetate |