(3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooct-1-yl)phosphonic acid structure
|
Common Name | (3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooct-1-yl)phosphonic acid | ||
|---|---|---|---|---|
| CAS Number | 252237-40-4 | Molecular Weight | 428.08400 | |
| Density | 1.706±0.06 g/cm3(Predicted) | Boiling Point | 276.4±50.0℃(Predicted) | |
| Molecular Formula | C8H6F13O3P | Melting Point | 168-173°C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylphosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.706±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 276.4±50.0℃(Predicted) |
| Melting Point | 168-173°C |
| Molecular Formula | C8H6F13O3P |
| Molecular Weight | 428.08400 |
| Exact Mass | 427.98500 |
| PSA | 67.34000 |
| LogP | 4.29300 |
| InChIKey | DEXIXSRZQUFPIK-UHFFFAOYSA-N |
| SMILES | O=P(O)(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Storage condition | 2-8℃ |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P280-P305 + P351 + P338-P337 + P313 |
| Hazard Codes | Xn |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
|
~92%
(3,3,4,4,5,5,6,... CAS#:252237-40-4 |
| Literature: Journal of Fluorine Chemistry, , vol. 130, # 7 p. 615 - 620 |
|
~%
(3,3,4,4,5,5,6,... CAS#:252237-40-4 |
| Literature: US2010/27192 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| EPF |
| Perfluorohexyl ethylphosphonic acid |
| 2-(perfluorohexyl)ethylphosphonic acid |
| Phosphonic acid,(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) |
| (3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooct-1-yl)phosphonic acid |
| (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phosphonic acid |
| Cheminox FHP 2OH |
| 1H,1H,2H,2H-tridecafluorooctyl-phosphonic acid |
| UNII-4H915F99WT |
| Phosphonic acid,p-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) |