Butanamide,N-(5-chloro-2-methylphenyl)-3-oxo- structure
|
Common Name | Butanamide,N-(5-chloro-2-methylphenyl)-3-oxo- | ||
|---|---|---|---|---|
| CAS Number | 25233-50-5 | Molecular Weight | 225.67100 | |
| Density | 1.247g/cm3 | Boiling Point | 386.1ºC at 760mmHg | |
| Molecular Formula | C11H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.3ºC | |
| Name | N-(5-chloro-2-methylphenyl)-3-oxobutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.247g/cm3 |
|---|---|
| Boiling Point | 386.1ºC at 760mmHg |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67100 |
| Flash Point | 187.3ºC |
| Exact Mass | 225.05600 |
| PSA | 46.17000 |
| LogP | 2.63900 |
| Vapour Pressure | 3.62E-06mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | SGUFPRJAMBWKAZ-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)Nc1cc(Cl)ccc1C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Acetoacet-5-chloro-2-toluidide |
| Acetessigsaeure-(5-chlor-2-methyl-anilid) |
| 1-acetoacetylamino-2-methyl-5-chlorobenzene |
| Acetoacet-5-chlor-o-toluidid |
| N-(5-Chloro-2-methyl-phenyl)-3-oxo-butyramide |